C46H86NS2Si6Sn+ — CID 16717321
[2-cyano-3,3-bis(sulfanyl)prop-2-enyl]-[2,4,6-tri(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]stannanylium (PubChem CID 16717321) has the molecular formula C46H86NS2Si6Sn+ and a molecular weight of 1004.56 g/mol. Its IUPAC name is [2-cyano-3,3-bis(sulfanyl)prop-2-enyl]-[2,4,6-tri(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]stannanylium.
| Compound Name | [2-cyano-3,3-bis(sulfanyl)prop-2-enyl]-[2,4,6-tri(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]stannanylium |
|---|---|
| PubChem CID | 16717321 |
| Molecular Formula | C46H86NS2Si6Sn+ |
| Molecular Weight | 1004.56 g/mol |
| Exact Mass | 1004.38 |
| IUPAC Name | [2-cyano-3,3-bis(sulfanyl)prop-2-enyl]-[2,4,6-tri(propan-2-yl)phenyl]-[2,4,6-tris[bis(trimethylsilyl)methyl]phenyl]stannanylium |
| SMILES | CC(C)c1cc(C(C)C)c([Sn+](CC(C#N)=C(S)S)c2c(C([Si](C)(C)C)[Si](C)(C)C)cc(C([Si](C)(C)C)[Si](C)(C)C)cc2C([Si](C)(C)C)[Si](C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C27H59Si6.C15H23.C4H4NS2.Sn/c1-28(2,3)25(29(4,5)6)22-19-23(26(30(7,8)9)31(10,11)12)21-24(20-22)27(32(13,14)15)33(16,17)18;1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6;1-3(2-5)4(6)7;/h19-20,25-27H,1-18H3;7-8,10-12H,1-6H3;6-7H,1H2;/q;;;+1 |
| InChIKey | PGJXLWMDJFBJDQ-UHFFFAOYSA-N |
| XLogP | 14.78 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1004.56 |
| LogP ≤ 5 | 14.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|