C17H18F3N3O2 — CID 167173261
8-butanoyl-5-methyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one (PubChem CID 167173261) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is 8-butanoyl-5-methyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one.
| Compound Name | 8-butanoyl-5-methyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one |
|---|---|
| PubChem CID | 167173261 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 8-butanoyl-5-methyl-3-(trifluoromethyl)-9,10-dihydro-7H-pyrido[3,4-c][1,5]naphthyridin-6-one |
| SMILES | CCCC(=O)N1CCc2c(c(=O)n(C)c3cc(C(F)(F)F)cnc23)C1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-3-4-14(24)23-6-5-11-12(9-23)16(25)22(2)13-7-10(17(18,19)20)8-21-15(11)13/h7-8H,3-6,9H2,1-2H3 |
| InChIKey | DNPXUWCSLAZQNT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|