C13H16F4N4 — CID 167173295
7-fluoro-4-methyl-10-propan-2-yl-5-(trifluoromethyl)-1,3,4,10-tetrazatricyclo[6.4.0.02,6]dodeca-2,5,7-triene (PubChem CID 167173295) has the molecular formula C13H16F4N4 and a molecular weight of 304.29 g/mol. Its IUPAC name is 7-fluoro-4-methyl-10-propan-2-yl-5-(trifluoromethyl)-1,3,4,10-tetrazatricyclo[6.4.0.02,6]dodeca-2,5,7-triene.
| Compound Name | 7-fluoro-4-methyl-10-propan-2-yl-5-(trifluoromethyl)-1,3,4,10-tetrazatricyclo[6.4.0.02,6]dodeca-2,5,7-triene |
|---|---|
| PubChem CID | 167173295 |
| Molecular Formula | C13H16F4N4 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 7-fluoro-4-methyl-10-propan-2-yl-5-(trifluoromethyl)-1,3,4,10-tetrazatricyclo[6.4.0.02,6]dodeca-2,5,7-triene |
| SMILES | CC(C)N1CCn2c(c(F)c3c(C(F)(F)F)n(C)nc32)C1 |
| InChI | InChI=1S/C13H16F4N4/c1-7(2)20-4-5-21-8(6-20)10(14)9-11(13(15,16)17)19(3)18-12(9)21/h7H,4-6H2,1-3H3 |
| InChIKey | XSSNQOJKACEPRP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |