C20H32N6 — CID 167173323
8-methyl-9-methylidene-5-(4-methylpiperazin-1-yl)-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene (PubChem CID 167173323) has the molecular formula C20H32N6 and a molecular weight of 356.52 g/mol. Its IUPAC name is 8-methyl-9-methylidene-5-(4-methylpiperazin-1-yl)-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene.
| Compound Name | 8-methyl-9-methylidene-5-(4-methylpiperazin-1-yl)-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 167173323 |
| Molecular Formula | C20H32N6 |
| Molecular Weight | 356.52 g/mol |
| Exact Mass | 356.27 |
| IUPAC Name | 8-methyl-9-methylidene-5-(4-methylpiperazin-1-yl)-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
| SMILES | C=C1C2CN(C(C)C)CCN2c2ncc(N3CCN(C)CC3)cc2N1C |
| InChI | InChI=1S/C20H32N6/c1-15(2)25-10-11-26-19(14-25)16(3)23(5)18-12-17(13-21-20(18)26)24-8-6-22(4)7-9-24/h12-13,15,19H,3,6-11,14H2,1-2,4-5H3 |
| InChIKey | HWFIKVFSGZVCLG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 29.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.52 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |