C12H14BrClN4O — CID 167173344
(10S)-5-bromo-4-chloro-8,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one (PubChem CID 167173344) has the molecular formula C12H14BrClN4O and a molecular weight of 345.63 g/mol. Its IUPAC name is (10S)-5-bromo-4-chloro-8,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one.
| Compound Name | (10S)-5-bromo-4-chloro-8,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one |
|---|---|
| PubChem CID | 167173344 |
| Molecular Formula | C12H14BrClN4O |
| Molecular Weight | 345.63 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | (10S)-5-bromo-4-chloro-8,12-dimethyl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-9-one |
| SMILES | CN1CCN2c3nc(Cl)c(Br)cc3N(C)C(=O)[C@@H]2C1 |
| InChI | InChI=1S/C12H14BrClN4O/c1-16-3-4-18-9(6-16)12(19)17(2)8-5-7(13)10(14)15-11(8)18/h5,9H,3-4,6H2,1-2H3/t9-/m0/s1 |
| InChIKey | SPKJAUFJQVVFLR-VIFPVBQESA-N |
| XLogP | 1.59 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.63 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|