C15H16F4IN3 — CID 167173346
5-fluoro-8-iodo-5-prop-1-en-2-yl-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine (PubChem CID 167173346) has the molecular formula C15H16F4IN3 and a molecular weight of 441.21 g/mol. Its IUPAC name is 5-fluoro-8-iodo-5-prop-1-en-2-yl-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine.
| Compound Name | 5-fluoro-8-iodo-5-prop-1-en-2-yl-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine |
|---|---|
| PubChem CID | 167173346 |
| Molecular Formula | C15H16F4IN3 |
| Molecular Weight | 441.21 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | 5-fluoro-8-iodo-5-prop-1-en-2-yl-3-(trifluoromethyl)-6a,7,9,10-tetrahydro-6H-pyrazino[1,2-a][1,8]naphthyridine |
| SMILES | C=C(C)C1(F)CC2CN(I)CCN2c2ncc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C15H16F4IN3/c1-9(2)14(16)6-11-8-22(20)3-4-23(11)13-12(14)5-10(7-21-13)15(17,18)19/h5,7,11H,1,3-4,6,8H2,2H3 |
| InChIKey | QJJSXVUBCCFVKK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|