C16H23IN4 — CID 167173701
4-iodo-5,8-dimethyl-9-methylidene-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene (PubChem CID 167173701) has the molecular formula C16H23IN4 and a molecular weight of 398.29 g/mol. Its IUPAC name is 4-iodo-5,8-dimethyl-9-methylidene-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene.
| Compound Name | 4-iodo-5,8-dimethyl-9-methylidene-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 167173701 |
| Molecular Formula | C16H23IN4 |
| Molecular Weight | 398.29 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | 4-iodo-5,8-dimethyl-9-methylidene-12-propan-2-yl-1,3,8,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2(7),3,5-triene |
| SMILES | C=C1C2CN(C(C)C)CCN2c2nc(I)c(C)cc2N1C |
| InChI | InChI=1S/C16H23IN4/c1-10(2)20-6-7-21-14(9-20)12(4)19(5)13-8-11(3)15(17)18-16(13)21/h8,10,14H,4,6-7,9H2,1-3,5H3 |
| InChIKey | YUSHECMGVAGWRY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.29 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|