C12H11F3IN3 — CID 167173871
11-iodo-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene (PubChem CID 167173871) has the molecular formula C12H11F3IN3 and a molecular weight of 381.14 g/mol. Its IUPAC name is 11-iodo-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene.
| Compound Name | 11-iodo-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
|---|---|
| PubChem CID | 167173871 |
| Molecular Formula | C12H11F3IN3 |
| Molecular Weight | 381.14 g/mol |
| Exact Mass | 380.99 |
| IUPAC Name | 11-iodo-8-methyl-5-(trifluoromethyl)-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5,8-tetraene |
| SMILES | Cc1c2n(c3ncc(C(F)(F)F)cc13)CCN(I)C2 |
| InChI | InChI=1S/C12H11F3IN3/c1-7-9-4-8(12(13,14)15)5-17-11(9)19-3-2-18(16)6-10(7)19/h4-5H,2-3,6H2,1H3 |
| InChIKey | NGCVVNKPEKFIBS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.14 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|