C10H13Cl2N — CID 167174171
(9R,9aS)-2,9-dichloro-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine (PubChem CID 167174171) has the molecular formula C10H13Cl2N and a molecular weight of 218.13 g/mol. Its IUPAC name is (9R,9aS)-2,9-dichloro-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine.
| Compound Name | (9R,9aS)-2,9-dichloro-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 167174171 |
| Molecular Formula | C10H13Cl2N |
| Molecular Weight | 218.13 g/mol |
| Exact Mass | 217.04 |
| IUPAC Name | (9R,9aS)-2,9-dichloro-5,6,7,8,9,9a-hexahydro-4aH-cyclohepta[b]pyridine |
| SMILES | ClC1=N[C@H]2C(C=C1)CCCC[C@H]2Cl |
| InChI | InChI=1S/C10H13Cl2N/c11-8-4-2-1-3-7-5-6-9(12)13-10(7)8/h5-8,10H,1-4H2/t7?,8-,10+/m1/s1 |
| InChIKey | JJAVAKWWBRBKLS-VWHDNNRLSA-N |
| XLogP | 3.36 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.13 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|