About 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole
4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole (PubChem CID 167175211) has the molecular formula C11H21N3
and a molecular weight of 195.31 g/mol. Its IUPAC name is 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole.
Molecular Properties
| Compound Name | 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole |
| PubChem CID | 167175211 |
| Molecular Formula | C11H21N3 |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.17 |
| IUPAC Name | 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole |
| SMILES | CCn1cc(C(C)(C)CC(C)C)nn1 |
| InChI | InChI=1S/C11H21N3/c1-6-14-8-10(12-13-14)11(4,5)7-9(2)3/h8-9H,6-7H2,1-5H3 |
| InChIKey | OKPASWJSZVBHKR-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole?
The IUPAC name of 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole (CID 167175211) is 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole.
What is the SMILES notation for 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole?
The canonical SMILES for 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole is CCn1cc(C(C)(C)CC(C)C)nn1.
What is the InChIKey of 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole?
The InChIKey is OKPASWJSZVBHKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21N3/c1-6-14-8-10(12-13-14)11(4,5)7-9(2)3/h8-9H,6-7H2,1-5H3.
What are the key properties of 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole?
4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole has a molecular weight of 195.31 g/mol, XLogP of 2.62, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dimethylpentan-2-yl)-1-ethyltriazole is sourced from PubChem (CID 167175211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).