C12H24N2O5 — CID 167176103
N-[2-(butylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 167176103) has the molecular formula C12H24N2O5 and a molecular weight of 276.33 g/mol. Its IUPAC name is N-[2-(butylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[2-(butylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 167176103 |
| Molecular Formula | C12H24N2O5 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | N-[2-(butylamino)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CCCCNC1OC(CO)C(O)C(O)C1NC(C)=O |
| InChI | InChI=1S/C12H24N2O5/c1-3-4-5-13-12-9(14-7(2)16)11(18)10(17)8(6-15)19-12/h8-13,15,17-18H,3-6H2,1-2H3,(H,14,16) |
| InChIKey | PAFLEJMZNOVICJ-UHFFFAOYSA-N |
| XLogP | -1.68 |
| TPSA | 111.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | -1.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|