C63H47N3 — CID 167178155
9-[4-[4-[(3E,5E)-6-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazole (PubChem CID 167178155) has the molecular formula C63H47N3 and a molecular weight of 846.09 g/mol. Its IUPAC name is 9-[4-[4-[(3E,5E)-6-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazole.
| Compound Name | 9-[4-[4-[(3E,5E)-6-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazole |
|---|---|
| PubChem CID | 167178155 |
| Molecular Formula | C63H47N3 |
| Molecular Weight | 846.09 g/mol |
| Exact Mass | 845.38 |
| IUPAC Name | 9-[4-[4-[(3E,5E)-6-(9,9-dimethylspiro[anthracene-10,9'-fluorene]-2'-yl)hepta-1,3,5-trien-4-yl]-6-phenylpyrimidin-2-yl]phenyl]carbazole |
| SMILES | C=C/C=C(\C=C(/C)c1ccc2c(c1)C1(c3ccccc3-2)c2ccccc2C(C)(C)c2ccccc21)c1cc(-c2ccccc2)nc(-c2ccc(-n3c4ccccc4c4ccccc43)cc2)n1 |
| InChI | InChI=1S/C63H47N3/c1-5-19-45(38-41(2)44-34-37-48-47-22-9-12-25-51(47)63(56(48)39-44)54-28-15-13-26-52(54)62(3,4)53-27-14-16-29-55(53)63)58-40-57(42-20-7-6-8-21-42)64-61(65-58)43-32-35-46(36-33-43)66-59-30-17-10-23-49(59)50-24-11-18-31-60(50)66/h5-40H,1H2,2-4H3/b41-38+,45-19+ |
| InChIKey | CBSOOFPANBNGCE-JCHVJBSYSA-N |
| XLogP | 15.58 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.09 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|