C8H14N2 — CID 167178545
(1Z,3Z)-N,N-dimethyl-1-(methylideneamino)penta-1,3-dien-1-amine (PubChem CID 167178545) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (1Z,3Z)-N,N-dimethyl-1-(methylideneamino)penta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-N,N-dimethyl-1-(methylideneamino)penta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 167178545 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (1Z,3Z)-N,N-dimethyl-1-(methylideneamino)penta-1,3-dien-1-amine |
| SMILES | C=N/C(=C\C=C/C)N(C)C |
| InChI | InChI=1S/C8H14N2/c1-5-6-7-8(9-2)10(3)4/h5-7H,2H2,1,3-4H3/b6-5-,8-7+ |
| InChIKey | DZXXVFJNFDDWIO-IGTJQSIKSA-N |
| XLogP | 1.67 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|