C25H41N3 — CID 167178987
N-[2-[(4E,6Z)-2-(cyclohexylamino)-3-methylideneocta-1,4,6-trien-4-yl]iminopropyl]-3-methylcyclohexan-1-amine (PubChem CID 167178987) has the molecular formula C25H41N3 and a molecular weight of 383.62 g/mol. Its IUPAC name is N-[2-[(4E,6Z)-2-(cyclohexylamino)-3-methylideneocta-1,4,6-trien-4-yl]iminopropyl]-3-methylcyclohexan-1-amine.
| Compound Name | N-[2-[(4E,6Z)-2-(cyclohexylamino)-3-methylideneocta-1,4,6-trien-4-yl]iminopropyl]-3-methylcyclohexan-1-amine |
|---|---|
| PubChem CID | 167178987 |
| Molecular Formula | C25H41N3 |
| Molecular Weight | 383.62 g/mol |
| Exact Mass | 383.33 |
| IUPAC Name | N-[2-[(4E,6Z)-2-(cyclohexylamino)-3-methylideneocta-1,4,6-trien-4-yl]iminopropyl]-3-methylcyclohexan-1-amine |
| SMILES | C=C(NC1CCCCC1)C(=C)C(=C\C=C/C)/N=C(\C)CNC1CCCC(C)C1 |
| InChI | InChI=1S/C25H41N3/c1-6-7-16-25(21(4)22(5)28-23-13-9-8-10-14-23)27-20(3)18-26-24-15-11-12-19(2)17-24/h6-7,16,19,23-24,26,28H,4-5,8-15,17-18H2,1-3H3/b7-6-,25-16+,27-20+ |
| InChIKey | QCVJOGRVQFDKEZ-VXIBKCAASA-N |
| XLogP | 6.07 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.62 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|