About 2-isocyanatonaphthalene
2-isocyanatonaphthalene (PubChem CID 16718) has the molecular formula C11H7NO
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-isocyanatonaphthalene.
Molecular Properties
| Compound Name | 2-isocyanatonaphthalene |
| PubChem CID | 16718 |
| Molecular Formula | C11H7NO |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.05 |
| IUPAC Name | 2-isocyanatonaphthalene |
| SMILES | O=C=Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H7NO/c13-8-12-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H |
| InChIKey | XIXJQNFTNSQTBT-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatonaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatonaphthalene?
The IUPAC name of 2-isocyanatonaphthalene (CID 16718) is 2-isocyanatonaphthalene.
What is the SMILES notation for 2-isocyanatonaphthalene?
The canonical SMILES for 2-isocyanatonaphthalene is O=C=Nc1ccc2ccccc2c1.
What is the InChIKey of 2-isocyanatonaphthalene?
The InChIKey is XIXJQNFTNSQTBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NO/c13-8-12-11-6-5-9-3-1-2-4-10(9)7-11/h1-7H.
What are the key properties of 2-isocyanatonaphthalene?
2-isocyanatonaphthalene has a molecular weight of 169.18 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatonaphthalene is sourced from PubChem (CID 16718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).