C26H35F6N3O5 — CID 167180713
1-[(3aS)-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-3-[(2S)-2-[4-fluoro-2-[(2S)-2-(trifluoromethyl)oxetan-2-yl]phenoxy]-6-(methylamino)heptan-3-yl]urea (PubChem CID 167180713) has the molecular formula C26H35F6N3O5 and a molecular weight of 583.57 g/mol. Its IUPAC name is 1-[(3aS)-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-3-[(2S)-2-[4-fluoro-2-[(2S)-2-(trifluoromethyl)oxetan-2-yl]phenoxy]-6-(methylamino)heptan-3-yl]urea.
| Compound Name | 1-[(3aS)-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-3-[(2S)-2-[4-fluoro-2-[(2S)-2-(trifluoromethyl)oxetan-2-yl]phenoxy]-6-(methylamino)heptan-3-yl]urea |
|---|---|
| PubChem CID | 167180713 |
| Molecular Formula | C26H35F6N3O5 |
| Molecular Weight | 583.57 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | 1-[(3aS)-2,2-difluoro-3a,4,5,6,7,7a-hexahydro-1,3-benzodioxol-5-yl]-3-[(2S)-2-[4-fluoro-2-[(2S)-2-(trifluoromethyl)oxetan-2-yl]phenoxy]-6-(methylamino)heptan-3-yl]urea |
| SMILES | CNC(C)CCC(NC(=O)NC1CCC2OC(F)(F)O[C@H]2C1)[C@H](C)Oc1ccc(F)cc1[C@]1(C(F)(F)F)CCO1 |
| InChI | InChI=1S/C26H35F6N3O5/c1-14(33-3)4-7-19(35-23(36)34-17-6-9-21-22(13-17)40-26(31,32)39-21)15(2)38-20-8-5-16(27)12-18(20)24(10-11-37-24)25(28,29)30/h5,8,12,14-15,17,19,21-22,33H,4,6-7,9-11,13H2,1-3H3,(H2,34,35,36)/t14?,15-,17?,19?,21?,22-,24-/m0/s1 |
| InChIKey | UNHLEWIJOZZFCX-ZAGHFTOISA-N |
| XLogP | 4.71 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |