C27H31ClF5N3O3 — CID 167180815
1-(4-chloro-2-fluorophenyl)-3-[2-[4-fluoro-2-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]-4-pentylpiperidin-3-yl]urea (PubChem CID 167180815) has the molecular formula C27H31ClF5N3O3 and a molecular weight of 576.01 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-3-[2-[4-fluoro-2-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]-4-pentylpiperidin-3-yl]urea.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-3-[2-[4-fluoro-2-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]-4-pentylpiperidin-3-yl]urea |
|---|---|
| PubChem CID | 167180815 |
| Molecular Formula | C27H31ClF5N3O3 |
| Molecular Weight | 576.01 g/mol |
| Exact Mass | 575.20 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-3-[2-[4-fluoro-2-[2-(trifluoromethyl)oxetan-2-yl]phenoxy]-4-pentylpiperidin-3-yl]urea |
| SMILES | CCCCCC1CCNC(Oc2ccc(F)cc2C2(C(F)(F)F)CCO2)C1NC(=O)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C27H31ClF5N3O3/c1-2-3-4-5-16-10-12-34-24(23(16)36-25(37)35-21-8-6-17(28)14-20(21)30)39-22-9-7-18(29)15-19(22)26(11-13-38-26)27(31,32)33/h6-9,14-16,23-24,34H,2-5,10-13H2,1H3,(H2,35,36,37) |
| InChIKey | ABLCUSBJUNLSCC-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.01 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|