C21H26F6O6S2 — CID 167181142
3-(2,6-dicyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid (PubChem CID 167181142) has the molecular formula C21H26F6O6S2 and a molecular weight of 552.56 g/mol. Its IUPAC name is 3-(2,6-dicyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid.
| Compound Name | 3-(2,6-dicyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
|---|---|
| PubChem CID | 167181142 |
| Molecular Formula | C21H26F6O6S2 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 3-(2,6-dicyclohexylphenoxy)sulfonyl-1,1,2,2,3,3-hexafluoropropane-1-sulfonic acid |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)Oc1c(C2CCCCC2)cccc1C1CCCCC1 |
| InChI | InChI=1S/C21H26F6O6S2/c22-19(23,20(24,25)34(28,29)30)21(26,27)35(31,32)33-18-16(14-8-3-1-4-9-14)12-7-13-17(18)15-10-5-2-6-11-15/h7,12-15H,1-6,8-11H2,(H,28,29,30) |
| InChIKey | IHFNZSAWOGVABC-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|