C29H21F3O3S — CID 167181173
4-[[6-(phenoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]methyl]phenol (PubChem CID 167181173) has the molecular formula C29H21F3O3S and a molecular weight of 506.55 g/mol. Its IUPAC name is 4-[[6-(phenoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]methyl]phenol.
| Compound Name | 4-[[6-(phenoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]methyl]phenol |
|---|---|
| PubChem CID | 167181173 |
| Molecular Formula | C29H21F3O3S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 4-[[6-(phenoxymethyl)-2-[4-(trifluoromethoxy)phenyl]-1-benzothiophen-3-yl]methyl]phenol |
| SMILES | Oc1ccc(Cc2c(-c3ccc(OC(F)(F)F)cc3)sc3cc(COc4ccccc4)ccc23)cc1 |
| InChI | InChI=1S/C29H21F3O3S/c30-29(31,32)35-24-13-9-21(10-14-24)28-26(16-19-6-11-22(33)12-7-19)25-15-8-20(17-27(25)36-28)18-34-23-4-2-1-3-5-23/h1-15,17,33H,16,18H2 |
| InChIKey | DMWBBSDHWHCHPV-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |