About 7-methyl-3aH-pyrazolo[3,4-c]pyridine
7-methyl-3aH-pyrazolo[3,4-c]pyridine (PubChem CID 167182575) has the molecular formula C7H7N3
and a molecular weight of 133.15 g/mol. Its IUPAC name is 7-methyl-3aH-pyrazolo[3,4-c]pyridine.
Molecular Properties
| Compound Name | 7-methyl-3aH-pyrazolo[3,4-c]pyridine |
| PubChem CID | 167182575 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | 7-methyl-3aH-pyrazolo[3,4-c]pyridine |
| SMILES | CC1=NC=CC2C=NN=C12 |
| InChI | InChI=1S/C7H7N3/c1-5-7-6(2-3-8-5)4-9-10-7/h2-4,6H,1H3 |
| InChIKey | AWRHZRJYCWEDOA-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-methyl-3aH-pyrazolo[3,4-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-3aH-pyrazolo[3,4-c]pyridine?
The IUPAC name of 7-methyl-3aH-pyrazolo[3,4-c]pyridine (CID 167182575) is 7-methyl-3aH-pyrazolo[3,4-c]pyridine.
What is the SMILES notation for 7-methyl-3aH-pyrazolo[3,4-c]pyridine?
The canonical SMILES for 7-methyl-3aH-pyrazolo[3,4-c]pyridine is CC1=NC=CC2C=NN=C12.
What is the InChIKey of 7-methyl-3aH-pyrazolo[3,4-c]pyridine?
The InChIKey is AWRHZRJYCWEDOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3/c1-5-7-6(2-3-8-5)4-9-10-7/h2-4,6H,1H3.
What are the key properties of 7-methyl-3aH-pyrazolo[3,4-c]pyridine?
7-methyl-3aH-pyrazolo[3,4-c]pyridine has a molecular weight of 133.15 g/mol, XLogP of 1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-3aH-pyrazolo[3,4-c]pyridine is sourced from PubChem (CID 167182575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).