C32H27F3N4O3S2 — CID 16718453
N-[[3-fluoro-4-[2-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide (PubChem CID 16718453) has the molecular formula C32H27F3N4O3S2 and a molecular weight of 636.72 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-[2-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 16718453 |
| Molecular Formula | C32H27F3N4O3S2 |
| Molecular Weight | 636.72 g/mol |
| Exact Mass | 636.15 |
| IUPAC Name | N-[[3-fluoro-4-[2-[2-fluoro-4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=S)NC(=O)Cc5ccc(F)cc5)cc4F)c3s2)c(F)c1 |
| InChI | InChI=1S/C32H27F3N4O3S2/c1-41-13-12-36-18-20-4-8-23(24(34)14-20)29-17-26-31(44-29)28(10-11-37-26)42-27-9-7-22(16-25(27)35)38-32(43)39-30(40)15-19-2-5-21(33)6-3-19/h2-11,14,16-17,36H,12-13,15,18H2,1H3,(H2,38,39,40,43) |
| InChIKey | QLYCYEQLSGZUSQ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.72 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|