C32H28F2N4O3S2 — CID 16718454
N-[[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide (PubChem CID 16718454) has the molecular formula C32H28F2N4O3S2 and a molecular weight of 618.73 g/mol. Its IUPAC name is N-[[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide.
| Compound Name | N-[[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 16718454 |
| Molecular Formula | C32H28F2N4O3S2 |
| Molecular Weight | 618.73 g/mol |
| Exact Mass | 618.16 |
| IUPAC Name | N-[[3-fluoro-4-[2-[4-[(2-methoxyethylamino)methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]carbamothioyl]-2-(4-fluorophenyl)acetamide |
| SMILES | COCCNCc1ccc(-c2cc3nccc(Oc4ccc(NC(=S)NC(=O)Cc5ccc(F)cc5)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C32H28F2N4O3S2/c1-40-15-14-35-19-21-2-6-22(7-3-21)29-18-26-31(43-29)28(12-13-36-26)41-27-11-10-24(17-25(27)34)37-32(42)38-30(39)16-20-4-8-23(33)9-5-20/h2-13,17-18,35H,14-16,19H2,1H3,(H2,37,38,39,42) |
| InChIKey | QMPCTTYTHMXZAX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 84.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.73 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|