C10H15NS3 — CID 167184582
5-propan-2-yl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione (PubChem CID 167184582) has the molecular formula C10H15NS3 and a molecular weight of 245.44 g/mol. Its IUPAC name is 5-propan-2-yl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione.
| Compound Name | 5-propan-2-yl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione |
|---|---|
| PubChem CID | 167184582 |
| Molecular Formula | C10H15NS3 |
| Molecular Weight | 245.44 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 5-propan-2-yl-6-sulfanyl-2,3,3a,6-tetrahydrothieno[3,2-c]pyridine-4-thione |
| SMILES | CC(C)N1C(=S)C2CCSC2=CC1S |
| InChI | InChI=1S/C10H15NS3/c1-6(2)11-9(12)5-8-7(10(11)13)3-4-14-8/h5-7,9,12H,3-4H2,1-2H3 |
| InChIKey | OBRZUKPIAVAPFQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|