About 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol
2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol (PubChem CID 167184807) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol.
Molecular Properties
| Compound Name | 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol |
| PubChem CID | 167184807 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol |
| SMILES | C[C@H]1C[C@@H]1OCC(N)CO |
| InChI | InChI=1S/C7H15NO2/c1-5-2-7(5)10-4-6(8)3-9/h5-7,9H,2-4,8H2,1H3/t5-,6?,7-/m0/s1 |
| InChIKey | CXNCGVCMOPUHPX-LOJRBXKRSA-N |
| XLogP | -0.27 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol?
The IUPAC name of 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol (CID 167184807) is 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol.
What is the SMILES notation for 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol?
The canonical SMILES for 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol is C[C@H]1C[C@@H]1OCC(N)CO.
What is the InChIKey of 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol?
The InChIKey is CXNCGVCMOPUHPX-LOJRBXKRSA-N. The full InChI is InChI=1S/C7H15NO2/c1-5-2-7(5)10-4-6(8)3-9/h5-7,9H,2-4,8H2,1H3/t5-,6?,7-/m0/s1.
What are the key properties of 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol?
2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol has a molecular weight of 145.20 g/mol, XLogP of -0.27, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3-[(1S,2S)-2-methylcyclopropyl]oxypropan-1-ol is sourced from PubChem (CID 167184807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).