C28H60N2 — CID 167184808
5,11-diethyl-2,4,4,5,11,12,12,14-octamethylhexadecane-2,14-diamine (PubChem CID 167184808) has the molecular formula C28H60N2 and a molecular weight of 424.80 g/mol. Its IUPAC name is 5,11-diethyl-2,4,4,5,11,12,12,14-octamethylhexadecane-2,14-diamine.
| Compound Name | 5,11-diethyl-2,4,4,5,11,12,12,14-octamethylhexadecane-2,14-diamine |
|---|---|
| PubChem CID | 167184808 |
| Molecular Formula | C28H60N2 |
| Molecular Weight | 424.80 g/mol |
| Exact Mass | 424.48 |
| IUPAC Name | 5,11-diethyl-2,4,4,5,11,12,12,14-octamethylhexadecane-2,14-diamine |
| SMILES | CCC(C)(N)CC(C)(C)C(C)(CC)CCCCCC(C)(CC)C(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C28H60N2/c1-13-26(10,23(4,5)21-25(8,9)29)19-17-16-18-20-27(11,14-2)24(6,7)22-28(12,30)15-3/h13-22,29-30H2,1-12H3 |
| InChIKey | ZSVOMHJPTVXHRL-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.80 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|