About (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile
(3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile (PubChem CID 167184890) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile |
| PubChem CID | 167184890 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile |
| SMILES | C=C(O)/C=C\C(C)C#N |
| InChI | InChI=1S/C7H9NO/c1-6(5-8)3-4-7(2)9/h3-4,6,9H,2H2,1H3/b4-3- |
| InChIKey | VQFPZMXAXVXDAU-ARJAWSKDSA-N |
| XLogP | 1.77 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile?
The IUPAC name of (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile (CID 167184890) is (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile.
What is the SMILES notation for (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile?
The canonical SMILES for (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile is C=C(O)/C=C\C(C)C#N.
What is the InChIKey of (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile?
The InChIKey is VQFPZMXAXVXDAU-ARJAWSKDSA-N. The full InChI is InChI=1S/C7H9NO/c1-6(5-8)3-4-7(2)9/h3-4,6,9H,2H2,1H3/b4-3-.
What are the key properties of (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile?
(3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile has a molecular weight of 123.15 g/mol, XLogP of 1.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-5-hydroxy-2-methylhexa-3,5-dienenitrile is sourced from PubChem (CID 167184890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).