C15H22N2O2 — CID 167185231
(2R,3Z)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-oxopyrrolidin-1-yl)methyl]hexa-3,5-dienenitrile (PubChem CID 167185231) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is (2R,3Z)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-oxopyrrolidin-1-yl)methyl]hexa-3,5-dienenitrile.
| Compound Name | (2R,3Z)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-oxopyrrolidin-1-yl)methyl]hexa-3,5-dienenitrile |
|---|---|
| PubChem CID | 167185231 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | (2R,3Z)-5-[(2-methylpropan-2-yl)oxy]-2-[(2-oxopyrrolidin-1-yl)methyl]hexa-3,5-dienenitrile |
| SMILES | C=C(/C=C\[C@@H](C#N)CN1CCCC1=O)OC(C)(C)C |
| InChI | InChI=1S/C15H22N2O2/c1-12(19-15(2,3)4)7-8-13(10-16)11-17-9-5-6-14(17)18/h7-8,13H,1,5-6,9,11H2,2-4H3/b8-7-/t13-/m0/s1 |
| InChIKey | UOYUAPPNDYEBEO-WSROAFLRSA-N |
| XLogP | 2.63 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|