C16H18ClN3O2 — CID 167185638
7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidine (PubChem CID 167185638) has the molecular formula C16H18ClN3O2 and a molecular weight of 319.79 g/mol. Its IUPAC name is 7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidine.
| Compound Name | 7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 167185638 |
| Molecular Formula | C16H18ClN3O2 |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 7-[(3aR,6R,6aS)-4-ethenyl-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]-4-chloro-5,6-dihydropyrrolo[2,3-d]pyrimidine |
| SMILES | C=CC1=C[C@@H](N2CCc3c(Cl)ncnc32)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C16H18ClN3O2/c1-4-9-7-11(13-12(9)21-16(2,3)22-13)20-6-5-10-14(17)18-8-19-15(10)20/h4,7-8,11-13H,1,5-6H2,2-3H3/t11-,12-,13+/m1/s1 |
| InChIKey | FVMRKYXJWYMZDF-UPJWGTAASA-N |
| XLogP | 2.51 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |