About (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one
(E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one (PubChem CID 167185728) has the molecular formula C10H16FIN2O
and a molecular weight of 326.15 g/mol. Its IUPAC name is (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one.
Molecular Properties
| Compound Name | (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one |
| PubChem CID | 167185728 |
| Molecular Formula | C10H16FIN2O |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one |
| SMILES | CC1CN(C(=O)/C=C/CF)C(C)CN1I |
| InChI | InChI=1S/C10H16FIN2O/c1-8-7-14(12)9(2)6-13(8)10(15)4-3-5-11/h3-4,8-9H,5-7H2,1-2H3/b4-3+ |
| InChIKey | SLYBYKKPTOUGAF-ONEGZZNKSA-N |
| XLogP | 1.78 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one?
The IUPAC name of (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one (CID 167185728) is (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one.
What is the SMILES notation for (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one?
The canonical SMILES for (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one is CC1CN(C(=O)/C=C/CF)C(C)CN1I.
What is the InChIKey of (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one?
The InChIKey is SLYBYKKPTOUGAF-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H16FIN2O/c1-8-7-14(12)9(2)6-13(8)10(15)4-3-5-11/h3-4,8-9H,5-7H2,1-2H3/b4-3+.
What are the key properties of (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one?
(E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one has a molecular weight of 326.15 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-4-fluoro-1-(4-iodo-2,5-dimethylpiperazin-1-yl)but-2-en-1-one is sourced from PubChem (CID 167185728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).