About (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine
(2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine (PubChem CID 167186463) has the molecular formula C9H14N2S
and a molecular weight of 182.29 g/mol. Its IUPAC name is (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine.
Molecular Properties
| Compound Name | (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine |
| PubChem CID | 167186463 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine |
| SMILES | C#C[C@@H](C)N(C)CC1CN=CS1 |
| InChI | InChI=1S/C9H14N2S/c1-4-8(2)11(3)6-9-5-10-7-12-9/h1,7-9H,5-6H2,2-3H3/t8-,9?/m1/s1 |
| InChIKey | MUALSHDROSZTHW-VEDVMXKPSA-N |
| XLogP | 1.08 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine?
The IUPAC name of (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine (CID 167186463) is (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine.
What is the SMILES notation for (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine?
The canonical SMILES for (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine is C#C[C@@H](C)N(C)CC1CN=CS1.
What is the InChIKey of (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine?
The InChIKey is MUALSHDROSZTHW-VEDVMXKPSA-N. The full InChI is InChI=1S/C9H14N2S/c1-4-8(2)11(3)6-9-5-10-7-12-9/h1,7-9H,5-6H2,2-3H3/t8-,9?/m1/s1.
What are the key properties of (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine?
(2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine has a molecular weight of 182.29 g/mol, XLogP of 1.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-N-(4,5-dihydro-1,3-thiazol-5-ylmethyl)-N-methylbut-3-yn-2-amine is sourced from PubChem (CID 167186463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).