About 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one
2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one (PubChem CID 167186692) has the molecular formula C13H11F3N2O
and a molecular weight of 268.24 g/mol. Its IUPAC name is 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one.
Molecular Properties
| Compound Name | 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one |
| PubChem CID | 167186692 |
| Molecular Formula | C13H11F3N2O |
| Molecular Weight | 268.24 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one |
| SMILES | C=C/C(=C\C)n1cc2c(C(F)(F)F)cccn2c1=O |
| InChI | InChI=1S/C13H11F3N2O/c1-3-9(4-2)18-8-11-10(13(14,15)16)6-5-7-17(11)12(18)19/h3-8H,1H2,2H3/b9-4+ |
| InChIKey | APGKJHLBSWZOEJ-RUDMXATFSA-N |
| XLogP | 3.17 |
| TPSA | 26.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.24 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one?
The IUPAC name of 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one (CID 167186692) is 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one.
What is the SMILES notation for 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one?
The canonical SMILES for 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one is C=C/C(=C\C)n1cc2c(C(F)(F)F)cccn2c1=O.
What is the InChIKey of 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one?
The InChIKey is APGKJHLBSWZOEJ-RUDMXATFSA-N. The full InChI is InChI=1S/C13H11F3N2O/c1-3-9(4-2)18-8-11-10(13(14,15)16)6-5-7-17(11)12(18)19/h3-8H,1H2,2H3/b9-4+.
What are the key properties of 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one?
2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one has a molecular weight of 268.24 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E)-penta-1,3-dien-3-yl]-8-(trifluoromethyl)imidazo[1,5-a]pyridin-3-one is sourced from PubChem (CID 167186692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).