C13H18N4O — CID 167186757
(3E)-4-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]hexa-1,3,5-trien-2-amine (PubChem CID 167186757) has the molecular formula C13H18N4O and a molecular weight of 246.31 g/mol. Its IUPAC name is (3E)-4-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]hexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-4-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]hexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 167186757 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | (3E)-4-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]hexa-1,3,5-trien-2-amine |
| SMILES | C=C/C(=C\C(=C)N)C1(Cc2nncn2C)COC1 |
| InChI | InChI=1S/C13H18N4O/c1-4-11(5-10(2)14)13(7-18-8-13)6-12-16-15-9-17(12)3/h4-5,9H,1-2,6-8,14H2,3H3/b11-5+ |
| InChIKey | JUPUPCNSDBKEAF-VZUCSPMQSA-N |
| XLogP | 0.96 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|