About 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline
3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline (PubChem CID 167186899) has the molecular formula C13H15N3S
and a molecular weight of 245.35 g/mol. Its IUPAC name is 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline.
Molecular Properties
| Compound Name | 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline |
| PubChem CID | 167186899 |
| Molecular Formula | C13H15N3S |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline |
| SMILES | CC1CC(c2cccc(N)c2)(c2nncs2)C1 |
| InChI | InChI=1S/C13H15N3S/c1-9-6-13(7-9,12-16-15-8-17-12)10-3-2-4-11(14)5-10/h2-5,8-9H,6-7,14H2,1H3 |
| InChIKey | LUQXAXGRIZXKCA-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline?
The IUPAC name of 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline (CID 167186899) is 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline.
What is the SMILES notation for 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline?
The canonical SMILES for 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline is CC1CC(c2cccc(N)c2)(c2nncs2)C1.
What is the InChIKey of 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline?
The InChIKey is LUQXAXGRIZXKCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3S/c1-9-6-13(7-9,12-16-15-8-17-12)10-3-2-4-11(14)5-10/h2-5,8-9H,6-7,14H2,1H3.
What are the key properties of 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline?
3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline has a molecular weight of 245.35 g/mol, XLogP of 2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-methyl-1-(1,3,4-thiadiazol-2-yl)cyclobutyl]aniline is sourced from PubChem (CID 167186899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).