About (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine
(Z)-4-chloro-N,3-dimethylpent-3-en-2-imine (PubChem CID 167187204) has the molecular formula C7H12ClN
and a molecular weight of 145.63 g/mol. Its IUPAC name is (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine |
| PubChem CID | 167187204 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine |
| SMILES | C/N=C(C)/C(C)=C(/C)Cl |
| InChI | InChI=1S/C7H12ClN/c1-5(6(2)8)7(3)9-4/h1-4H3/b6-5-,9-7+ |
| InChIKey | VKSYRNVPJFJCNU-BZWSEGBZSA-N |
| XLogP | 2.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine?
The IUPAC name of (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine (CID 167187204) is (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine.
What is the SMILES notation for (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine?
The canonical SMILES for (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine is C/N=C(C)/C(C)=C(/C)Cl.
What is the InChIKey of (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine?
The InChIKey is VKSYRNVPJFJCNU-BZWSEGBZSA-N. The full InChI is InChI=1S/C7H12ClN/c1-5(6(2)8)7(3)9-4/h1-4H3/b6-5-,9-7+.
What are the key properties of (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine?
(Z)-4-chloro-N,3-dimethylpent-3-en-2-imine has a molecular weight of 145.63 g/mol, XLogP of 2.61, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-chloro-N,3-dimethylpent-3-en-2-imine is sourced from PubChem (CID 167187204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).