About (4,4-difluorocyclohexyl) 2-methylbutanoate
(4,4-difluorocyclohexyl) 2-methylbutanoate (PubChem CID 167187480) has the molecular formula C11H18F2O2
and a molecular weight of 220.26 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl) 2-methylbutanoate.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl) 2-methylbutanoate |
| PubChem CID | 167187480 |
| Molecular Formula | C11H18F2O2 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (4,4-difluorocyclohexyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H18F2O2/c1-3-8(2)10(14)15-9-4-6-11(12,13)7-5-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | JLNHLFRYSWFWFP-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-difluorocyclohexyl) 2-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl) 2-methylbutanoate?
The IUPAC name of (4,4-difluorocyclohexyl) 2-methylbutanoate (CID 167187480) is (4,4-difluorocyclohexyl) 2-methylbutanoate.
What is the SMILES notation for (4,4-difluorocyclohexyl) 2-methylbutanoate?
The canonical SMILES for (4,4-difluorocyclohexyl) 2-methylbutanoate is CCC(C)C(=O)OC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl) 2-methylbutanoate?
The InChIKey is JLNHLFRYSWFWFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2O2/c1-3-8(2)10(14)15-9-4-6-11(12,13)7-5-9/h8-9H,3-7H2,1-2H3.
What are the key properties of (4,4-difluorocyclohexyl) 2-methylbutanoate?
(4,4-difluorocyclohexyl) 2-methylbutanoate has a molecular weight of 220.26 g/mol, XLogP of 3.15, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl) 2-methylbutanoate is sourced from PubChem (CID 167187480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).