About 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione
2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione (PubChem CID 167188268) has the molecular formula C14H5Br2ClN2O2
and a molecular weight of 428.47 g/mol. Its IUPAC name is 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione.
Molecular Properties
| Compound Name | 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione |
| PubChem CID | 167188268 |
| Molecular Formula | C14H5Br2ClN2O2 |
| Molecular Weight | 428.47 g/mol |
| Exact Mass | 425.84 |
| IUPAC Name | 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione |
| SMILES | O=c1c2cc(Cl)ccc2n2c3c(Br)cc(Br)cc3c(=O)n12 |
| InChI | InChI=1S/C14H5Br2ClN2O2/c15-6-3-9-12(10(16)4-6)18-11-2-1-7(17)5-8(11)13(20)19(18)14(9)21/h1-5H |
| InChIKey | QBOUAIONRBYJAD-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 42.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione?
The IUPAC name of 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione (CID 167188268) is 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione.
What is the SMILES notation for 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione?
The canonical SMILES for 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione is O=c1c2cc(Cl)ccc2n2c3c(Br)cc(Br)cc3c(=O)n12.
What is the InChIKey of 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione?
The InChIKey is QBOUAIONRBYJAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H5Br2ClN2O2/c15-6-3-9-12(10(16)4-6)18-11-2-1-7(17)5-8(11)13(20)19(18)14(9)21/h1-5H.
What are the key properties of 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione?
2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione has a molecular weight of 428.47 g/mol, XLogP of 3.68, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-8-chloroindazolo[1,2-a]indazole-10,12-dione is sourced from PubChem (CID 167188268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).