About (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium
(2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium (PubChem CID 167188766) has the molecular formula C7H10F2O4P+
and a molecular weight of 227.12 g/mol. Its IUPAC name is (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium.
Molecular Properties
| Compound Name | (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium |
| PubChem CID | 167188766 |
| Molecular Formula | C7H10F2O4P+ |
| Molecular Weight | 227.12 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium |
| SMILES | CCC1([P+](C)(F)F)COC(=O)C(=O)O1 |
| InChI | InChI=1S/C7H10F2O4P/c1-3-7(14(2,8)9)4-12-5(10)6(11)13-7/h3-4H2,1-2H3/q+1 |
| InChIKey | ONFGJNOENOQSHU-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.12 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium?
The IUPAC name of (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium (CID 167188766) is (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium.
What is the SMILES notation for (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium?
The canonical SMILES for (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium is CCC1([P+](C)(F)F)COC(=O)C(=O)O1.
What is the InChIKey of (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium?
The InChIKey is ONFGJNOENOQSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10F2O4P/c1-3-7(14(2,8)9)4-12-5(10)6(11)13-7/h3-4H2,1-2H3/q+1.
What are the key properties of (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium?
(2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium has a molecular weight of 227.12 g/mol, XLogP of 1.61, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethyl-5,6-dioxo-1,4-dioxan-2-yl)-difluoro-methylphosphanium is sourced from PubChem (CID 167188766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).