C25H41NO8 — CID 16718971
(2S)-2-[[1-[[(1R,3R,4S)-3-butyl-4-oxalocyclohexyl]carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid (PubChem CID 16718971) has the molecular formula C25H41NO8 and a molecular weight of 483.60 g/mol. Its IUPAC name is (2S)-2-[[1-[[(1R,3R,4S)-3-butyl-4-oxalocyclohexyl]carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid.
| Compound Name | (2S)-2-[[1-[[(1R,3R,4S)-3-butyl-4-oxalocyclohexyl]carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid |
|---|---|
| PubChem CID | 16718971 |
| Molecular Formula | C25H41NO8 |
| Molecular Weight | 483.60 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | (2S)-2-[[1-[[(1R,3R,4S)-3-butyl-4-oxalocyclohexyl]carbamoyl]cyclopentyl]methyl]-3-(2-methoxyethoxy)propanoic acid |
| SMILES | CCCC[C@@H]1C[C@H](NC(=O)C2(C[C@@H](COCCOC)C(=O)O)CCCC2)CC[C@@H]1C(=O)C(=O)O |
| InChI | InChI=1S/C25H41NO8/c1-3-4-7-17-14-19(8-9-20(17)21(27)23(30)31)26-24(32)25(10-5-6-11-25)15-18(22(28)29)16-34-13-12-33-2/h17-20H,3-16H2,1-2H3,(H,26,32)(H,28,29)(H,30,31)/t17-,18+,19-,20+/m1/s1 |
| InChIKey | QEPZHVMRGFZTEA-WCIQWLHISA-N |
| XLogP | 3.05 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|