About 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol
7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol (PubChem CID 167190003) has the molecular formula C14H31NS3
and a molecular weight of 309.61 g/mol. Its IUPAC name is 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol.
Molecular Properties
| Compound Name | 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol |
| PubChem CID | 167190003 |
| Molecular Formula | C14H31NS3 |
| Molecular Weight | 309.61 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol |
| SMILES | CC(CS)CCC(S)C(C)CSCC(N)C(C)C |
| InChI | InChI=1S/C14H31NS3/c1-10(2)13(15)9-18-8-12(4)14(17)6-5-11(3)7-16/h10-14,16-17H,5-9,15H2,1-4H3 |
| InChIKey | LRXCUAFSQZOSCR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.61 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol?
The IUPAC name of 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol (CID 167190003) is 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol.
What is the SMILES notation for 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol?
The canonical SMILES for 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol is CC(CS)CCC(S)C(C)CSCC(N)C(C)C.
What is the InChIKey of 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol?
The InChIKey is LRXCUAFSQZOSCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H31NS3/c1-10(2)13(15)9-18-8-12(4)14(17)6-5-11(3)7-16/h10-14,16-17H,5-9,15H2,1-4H3.
What are the key properties of 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol?
7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol has a molecular weight of 309.61 g/mol, XLogP of 3.98, 10 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-amino-3-methylbutyl)sulfanyl-2,6-dimethylheptane-1,5-dithiol is sourced from PubChem (CID 167190003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).