About tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate
tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate (PubChem CID 167190380) has the molecular formula C15H27N3O4
and a molecular weight of 313.40 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate |
| PubChem CID | 167190380 |
| Molecular Formula | C15H27N3O4 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate |
| SMILES | C=CC/N=C(\NC(=O)OC(C)(C)C)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N3O4/c1-9-10-16-11(17-12(19)21-14(2,3)4)18(8)13(20)22-15(5,6)7/h9H,1,10H2,2-8H3,(H,16,17,19) |
| InChIKey | MPZHHKBJIBGZPI-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 80.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate?
The IUPAC name of tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate (CID 167190380) is tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate.
What is the SMILES notation for tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate?
The canonical SMILES for tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate is C=CC/N=C(\NC(=O)OC(C)(C)C)N(C)C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate?
The InChIKey is MPZHHKBJIBGZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O4/c1-9-10-16-11(17-12(19)21-14(2,3)4)18(8)13(20)22-15(5,6)7/h9H,1,10H2,2-8H3,(H,16,17,19).
What are the key properties of tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate?
tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate has a molecular weight of 313.40 g/mol, XLogP of 2.92, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-methyl-N-[N-[(2-methylpropan-2-yl)oxycarbonyl]-N'-prop-2-enylcarbamimidoyl]carbamate is sourced from PubChem (CID 167190380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).