C18H22N2O — CID 167190467
2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide (PubChem CID 167190467) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide.
| Compound Name | 2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide |
|---|---|
| PubChem CID | 167190467 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-methyl-N-[(3Z)-penta-1,3-dien-2-yl]-4-(1,2,3,6-tetrahydropyridin-4-yl)benzamide |
| SMILES | C=C(/C=C\C)NC(=O)c1ccc(C2=CCNCC2)cc1C |
| InChI | InChI=1S/C18H22N2O/c1-4-5-14(3)20-18(21)17-7-6-16(12-13(17)2)15-8-10-19-11-9-15/h4-8,12,19H,3,9-11H2,1-2H3,(H,20,21)/b5-4- |
| InChIKey | ICIXYPPCXKKMIB-PLNGDYQASA-N |
| XLogP | 3.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|