C17H29F2N3 — CID 167190728
5-[(1R,3S)-2,2-difluoro-1,3-dimethylcyclopropyl]-3-methyl-4-N-(methylideneamino)-1-N-[(3Z)-penta-1,3-dien-2-yl]pentane-1,4-diamine (PubChem CID 167190728) has the molecular formula C17H29F2N3 and a molecular weight of 313.44 g/mol. Its IUPAC name is 5-[(1R,3S)-2,2-difluoro-1,3-dimethylcyclopropyl]-3-methyl-4-N-(methylideneamino)-1-N-[(3Z)-penta-1,3-dien-2-yl]pentane-1,4-diamine.
| Compound Name | 5-[(1R,3S)-2,2-difluoro-1,3-dimethylcyclopropyl]-3-methyl-4-N-(methylideneamino)-1-N-[(3Z)-penta-1,3-dien-2-yl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 167190728 |
| Molecular Formula | C17H29F2N3 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 5-[(1R,3S)-2,2-difluoro-1,3-dimethylcyclopropyl]-3-methyl-4-N-(methylideneamino)-1-N-[(3Z)-penta-1,3-dien-2-yl]pentane-1,4-diamine |
| SMILES | C=NNC(C[C@]1(C)[C@H](C)C1(F)F)C(C)CCNC(=C)/C=C\C |
| InChI | InChI=1S/C17H29F2N3/c1-7-8-13(3)21-10-9-12(2)15(22-20-6)11-16(5)14(4)17(16,18)19/h7-8,12,14-15,21-22H,3,6,9-11H2,1-2,4-5H3/b8-7-/t12?,14-,15?,16+/m0/s1 |
| InChIKey | HYXHWLMWPSRXBN-VVIUUYJDSA-N |
| XLogP | 3.95 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|