C31H30F2N8O2 — CID 167190799
1-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrimido[5,4-c]pyridazin-3-yl]-8-ethynyl-7-fluoro-2H-isoquinolin-3-one (PubChem CID 167190799) has the molecular formula C31H30F2N8O2 and a molecular weight of 584.63 g/mol. Its IUPAC name is 1-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrimido[5,4-c]pyridazin-3-yl]-8-ethynyl-7-fluoro-2H-isoquinolin-3-one.
| Compound Name | 1-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrimido[5,4-c]pyridazin-3-yl]-8-ethynyl-7-fluoro-2H-isoquinolin-3-one |
|---|---|
| PubChem CID | 167190799 |
| Molecular Formula | C31H30F2N8O2 |
| Molecular Weight | 584.63 g/mol |
| Exact Mass | 584.25 |
| IUPAC Name | 1-[8-(3,8-diazabicyclo[3.2.1]octan-3-yl)-6-[[(2R,8S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrimido[5,4-c]pyridazin-3-yl]-8-ethynyl-7-fluoro-2H-isoquinolin-3-one |
| SMILES | C#Cc1c(F)ccc2cc(=O)[nH]c(-c3cc4nc(OC[C@@]56CCCN5C[C@H](F)C6)nc(N5CC6CCC(C5)N6)c4nn3)c12 |
| InChI | InChI=1S/C31H30F2N8O2/c1-2-21-22(33)7-4-17-10-25(42)36-27(26(17)21)24-11-23-28(39-38-24)29(40-14-19-5-6-20(15-40)34-19)37-30(35-23)43-16-31-8-3-9-41(31)13-18(32)12-31/h1,4,7,10-11,18-20,34H,3,5-6,8-9,12-16H2,(H,36,42)/t18-,19?,20?,31+/m1/s1 |
| InChIKey | CWVZKRKXVPRVBZ-RMIANRRMSA-N |
| XLogP | 2.94 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.63 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|