C19H17ClF2O4S — CID 167190868
(4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-methyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene (PubChem CID 167190868) has the molecular formula C19H17ClF2O4S and a molecular weight of 414.86 g/mol. Its IUPAC name is (4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-methyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene.
| Compound Name | (4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-methyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
|---|---|
| PubChem CID | 167190868 |
| Molecular Formula | C19H17ClF2O4S |
| Molecular Weight | 414.86 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | (4S,10bS)-10b-(4-chlorophenyl)sulfonyl-7,10-difluoro-4-methyl-2,4,4a,5-tetrahydro-1H-pyrano[3,4-c]chromene |
| SMILES | C[C@@H]1OCC[C@@]2(S(=O)(=O)c3ccc(Cl)cc3)c3c(F)ccc(F)c3OCC12 |
| InChI | InChI=1S/C19H17ClF2O4S/c1-11-14-10-26-18-16(22)7-6-15(21)17(18)19(14,8-9-25-11)27(23,24)13-4-2-12(20)3-5-13/h2-7,11,14H,8-10H2,1H3/t11-,14?,19-/m0/s1 |
| InChIKey | MWNPLWUOGZNJFU-TYOABCSZSA-N |
| XLogP | 4.10 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.86 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |