C21H32N4O3 — CID 167191234
12,15-bis[(2S)-2-hydroxypropyl]-9-oxa-1,12,15-triazatricyclo[9.6.1.03,8]octadeca-3(8),4,6-triene-5-carbonitrile (PubChem CID 167191234) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is 12,15-bis[(2S)-2-hydroxypropyl]-9-oxa-1,12,15-triazatricyclo[9.6.1.03,8]octadeca-3(8),4,6-triene-5-carbonitrile.
| Compound Name | 12,15-bis[(2S)-2-hydroxypropyl]-9-oxa-1,12,15-triazatricyclo[9.6.1.03,8]octadeca-3(8),4,6-triene-5-carbonitrile |
|---|---|
| PubChem CID | 167191234 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 12,15-bis[(2S)-2-hydroxypropyl]-9-oxa-1,12,15-triazatricyclo[9.6.1.03,8]octadeca-3(8),4,6-triene-5-carbonitrile |
| SMILES | C[C@H](O)CN1CCN2Cc3cc(C#N)ccc3OCC(C2)N(C[C@H](C)O)CC1 |
| InChI | InChI=1S/C21H32N4O3/c1-16(26)11-23-5-6-24-13-19-9-18(10-22)3-4-21(19)28-15-20(14-24)25(8-7-23)12-17(2)27/h3-4,9,16-17,20,26-27H,5-8,11-15H2,1-2H3/t16-,17-,20?/m0/s1 |
| InChIKey | HZWDSTQXSBTXQL-NBJLRHFZSA-N |
| XLogP | 0.50 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |