About 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran
3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran (PubChem CID 167191266) has the molecular formula C8H13FO
and a molecular weight of 144.19 g/mol. Its IUPAC name is 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran.
Molecular Properties
| Compound Name | 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran |
| PubChem CID | 167191266 |
| Molecular Formula | C8H13FO |
| Molecular Weight | 144.19 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran |
| SMILES | CC1OC(C(C)C)C=C1F |
| InChI | InChI=1S/C8H13FO/c1-5(2)8-4-7(9)6(3)10-8/h4-6,8H,1-3H3 |
| InChIKey | GJJSMSIFVYQCRW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.19 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran?
The IUPAC name of 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran (CID 167191266) is 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran.
What is the SMILES notation for 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran?
The canonical SMILES for 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran is CC1OC(C(C)C)C=C1F.
What is the InChIKey of 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran?
The InChIKey is GJJSMSIFVYQCRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13FO/c1-5(2)8-4-7(9)6(3)10-8/h4-6,8H,1-3H3.
What are the key properties of 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran?
3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran has a molecular weight of 144.19 g/mol, XLogP of 2.28, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-2-methyl-5-propan-2-yl-2,5-dihydrofuran is sourced from PubChem (CID 167191266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).