C13H26F3NO2 — CID 167191633
1,1,1-trifluoro-N-[2-(2-pentoxyethoxy)ethyl]butan-2-amine (PubChem CID 167191633) has the molecular formula C13H26F3NO2 and a molecular weight of 285.35 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[2-(2-pentoxyethoxy)ethyl]butan-2-amine.
| Compound Name | 1,1,1-trifluoro-N-[2-(2-pentoxyethoxy)ethyl]butan-2-amine |
|---|---|
| PubChem CID | 167191633 |
| Molecular Formula | C13H26F3NO2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 1,1,1-trifluoro-N-[2-(2-pentoxyethoxy)ethyl]butan-2-amine |
| SMILES | CCCCCOCCOCCNC(CC)C(F)(F)F |
| InChI | InChI=1S/C13H26F3NO2/c1-3-5-6-8-18-10-11-19-9-7-17-12(4-2)13(14,15)16/h12,17H,3-11H2,1-2H3 |
| InChIKey | RACSUQOUVGZVJA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|