C28H33NO5 — CID 167191761
methyl (2S)-2-[(1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carbonyl)amino]-3-phenylpropanoate (PubChem CID 167191761) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is methyl (2S)-2-[(1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carbonyl)amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[(1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carbonyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 167191761 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | methyl (2S)-2-[(1-hydroxy-3,6,6,9-tetramethyl-6a,7,8,10a-tetrahydrobenzo[c]chromene-2-carbonyl)amino]-3-phenylpropanoate |
| SMILES | COC(=O)[C@H](Cc1ccccc1)NC(=O)c1c(C)cc2c(c1O)C1C=C(C)CCC1C(C)(C)O2 |
| InChI | InChI=1S/C28H33NO5/c1-16-11-12-20-19(13-16)24-22(34-28(20,3)4)14-17(2)23(25(24)30)26(31)29-21(27(32)33-5)15-18-9-7-6-8-10-18/h6-10,13-14,19-21,30H,11-12,15H2,1-5H3,(H,29,31)/t19?,20?,21-/m0/s1 |
| InChIKey | LKCICJNDUKMJBW-CBNMVNINSA-N |
| XLogP | 4.83 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|