About 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine
2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine (PubChem CID 16719182) has the molecular formula C20H19Cl3F3NO3
and a molecular weight of 484.73 g/mol. Its IUPAC name is 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine.
Molecular Properties
| Compound Name | 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine |
| PubChem CID | 16719182 |
| Molecular Formula | C20H19Cl3F3NO3 |
| Molecular Weight | 484.73 g/mol |
| Exact Mass | 483.04 |
| IUPAC Name | 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1ccnc(OCCCCCOc2cc(Cl)cc(OCC=C(Cl)Cl)c2)c1 |
| InChI | InChI=1S/C20H19Cl3F3NO3/c21-15-11-16(13-17(12-15)29-9-5-18(22)23)28-7-2-1-3-8-30-19-10-14(4-6-27-19)20(24,25)26/h4-6,10-13H,1-3,7-9H2 |
| InChIKey | CYYSRYNHJBHSJE-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine?
The IUPAC name of 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine (CID 16719182) is 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine.
What is the SMILES notation for 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine?
The canonical SMILES for 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine is FC(F)(F)c1ccnc(OCCCCCOc2cc(Cl)cc(OCC=C(Cl)Cl)c2)c1.
What is the InChIKey of 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine?
The InChIKey is CYYSRYNHJBHSJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19Cl3F3NO3/c21-15-11-16(13-17(12-15)29-9-5-18(22)23)28-7-2-1-3-8-30-19-10-14(4-6-27-19)20(24,25)26/h4-6,10-13H,1-3,7-9H2.
What are the key properties of 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine?
2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine has a molecular weight of 484.73 g/mol, XLogP of 7.08, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[3-chloro-5-(3,3-dichloroprop-2-enoxy)phenoxy]pentoxy]-4-(trifluoromethyl)pyridine is sourced from PubChem (CID 16719182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).