C18H18FN7S — CID 167192192
6-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-N-[1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]pyrido[2,3-d]pyrimidin-4-amine (PubChem CID 167192192) has the molecular formula C18H18FN7S and a molecular weight of 383.46 g/mol. Its IUPAC name is 6-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-N-[1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]pyrido[2,3-d]pyrimidin-4-amine.
| Compound Name | 6-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-N-[1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]pyrido[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 167192192 |
| Molecular Formula | C18H18FN7S |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 6-[(1Z,3E)-4-fluoro-1-(methylideneamino)penta-1,3-dienyl]-N-[1-(5-methyl-1,3,4-thiadiazol-2-yl)ethyl]pyrido[2,3-d]pyrimidin-4-amine |
| SMILES | C=N/C(=C\C=C(/C)F)c1cnc2ncnc(NC(C)c3nnc(C)s3)c2c1 |
| InChI | InChI=1S/C18H18FN7S/c1-10(19)5-6-15(20-4)13-7-14-16(21-8-13)22-9-23-17(14)24-11(2)18-26-25-12(3)27-18/h5-9,11H,4H2,1-3H3,(H,21,22,23,24)/b10-5+,15-6- |
| InChIKey | YKDNSKVQESZIEZ-HOTMREQWSA-N |
| XLogP | 4.27 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|